C23H30N4O — CID 8547000
1-(4-benzylpiperidin-1-yl)-2-(4-pyridin-2-ylpiperazin-1-yl)ethanone (PubChem CID 8547000) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(4-pyridin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 8547000 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(c2ccccn2)CC1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N4O/c28-23(19-25-14-16-26(17-15-25)22-8-4-5-11-24-22)27-12-9-21(10-13-27)18-20-6-2-1-3-7-20/h1-8,11,21H,9-10,12-19H2 |
| InChIKey | BOLRACDUBWOTPP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |