C29H37N5O — CID 90560742
1-(4-benzylpiperidin-1-yl)-2-[4-[2-(2-phenylimidazol-1-yl)ethyl]piperazin-1-yl]ethanone (PubChem CID 90560742) has the molecular formula C29H37N5O and a molecular weight of 471.65 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-[4-[2-(2-phenylimidazol-1-yl)ethyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-[4-[2-(2-phenylimidazol-1-yl)ethyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90560742 |
| Molecular Formula | C29H37N5O |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-[4-[2-(2-phenylimidazol-1-yl)ethyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(CCn2ccnc2-c2ccccc2)CC1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H37N5O/c35-28(33-14-11-26(12-15-33)23-25-7-3-1-4-8-25)24-32-19-17-31(18-20-32)21-22-34-16-13-30-29(34)27-9-5-2-6-10-27/h1-10,13,16,26H,11-12,14-15,17-24H2 |
| InChIKey | QIZPNXUPRHFMOX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |