About 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone
2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone (PubChem CID 84594649) has the molecular formula C15H20F2N4O2
and a molecular weight of 326.35 g/mol. Its IUPAC name is 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone.
Molecular Properties
| Compound Name | 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone |
| PubChem CID | 84594649 |
| Molecular Formula | C15H20F2N4O2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone |
| SMILES | O=C(N1CCCN(c2ncccn2)CC1)C(F)(F)C1(O)CCC1 |
| InChI | InChI=1S/C15H20F2N4O2/c16-15(17,14(23)4-1-5-14)12(22)20-8-3-9-21(11-10-20)13-18-6-2-7-19-13/h2,6-7,23H,1,3-5,8-11H2 |
| InChIKey | JLCCGUIJNVXCLQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone?
The IUPAC name of 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone (CID 84594649) is 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone.
What is the SMILES notation for 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone?
The canonical SMILES for 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone is O=C(N1CCCN(c2ncccn2)CC1)C(F)(F)C1(O)CCC1.
What is the InChIKey of 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone?
The InChIKey is JLCCGUIJNVXCLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N4O2/c16-15(17,14(23)4-1-5-14)12(22)20-8-3-9-21(11-10-20)13-18-6-2-7-19-13/h2,6-7,23H,1,3-5,8-11H2.
What are the key properties of 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone?
2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone has a molecular weight of 326.35 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-2-(1-hydroxycyclobutyl)-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone is sourced from PubChem (CID 84594649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).