C15H22N4O — CID 78768063
2-cyclopentyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone (PubChem CID 78768063) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-cyclopentyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-cyclopentyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 78768063 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-cyclopentyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(CC1CCCC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C15H22N4O/c20-14(12-13-4-1-2-5-13)18-8-10-19(11-9-18)15-16-6-3-7-17-15/h3,6-7,13H,1-2,4-5,8-12H2 |
| InChIKey | DVQBZDUOWJHKGF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |