C14H18N6O3 — CID 99929142
(5S)-5-[2-oxo-2-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 99929142) has the molecular formula C14H18N6O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is (5S)-5-[2-oxo-2-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-oxo-2-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99929142 |
| Molecular Formula | C14H18N6O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (5S)-5-[2-oxo-2-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H](CC(=O)N2CCCN(c3ncccn3)CC2)N1 |
| InChI | InChI=1S/C14H18N6O3/c21-11(9-10-12(22)18-14(23)17-10)19-5-2-6-20(8-7-19)13-15-3-1-4-16-13/h1,3-4,10H,2,5-9H2,(H2,17,18,22,23)/t10-/m0/s1 |
| InChIKey | QBEFUFXSXGNQKZ-JTQLQIEISA-N |
| XLogP | -0.89 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|