C14H20N6O2 — CID 4887926
3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 4887926) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | 3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 4887926 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | O=C1NCCNC1CC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H20N6O2/c21-12(10-11-13(22)16-5-4-15-11)19-6-8-20(9-7-19)14-17-2-1-3-18-14/h1-3,11,15H,4-10H2,(H,16,22) |
| InChIKey | LAGXBWNUWXCJAE-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |