C22H28N6O2 — CID 45224864
3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-4-(2-phenylethyl)piperazin-2-one (PubChem CID 45224864) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-4-(2-phenylethyl)piperazin-2-one.
| Compound Name | 3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-4-(2-phenylethyl)piperazin-2-one |
|---|---|
| PubChem CID | 45224864 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-4-(2-phenylethyl)piperazin-2-one |
| SMILES | O=C1NCCN(CCc2ccccc2)C1CC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H28N6O2/c29-20(27-13-15-28(16-14-27)22-24-8-4-9-25-22)17-19-21(30)23-10-12-26(19)11-7-18-5-2-1-3-6-18/h1-6,8-9,19H,7,10-17H2,(H,23,30) |
| InChIKey | KSBNVXLYFGMNCF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |