C22H26N4O4 — CID 26333955
(3R)-4-benzyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one (PubChem CID 26333955) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is (3R)-4-benzyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one.
| Compound Name | (3R)-4-benzyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one |
|---|---|
| PubChem CID | 26333955 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (3R)-4-benzyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one |
| SMILES | O=C1NCCN(Cc2ccccc2)[C@@H]1CC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C22H26N4O4/c27-20(24-10-12-25(13-11-24)22(29)19-7-4-14-30-19)15-18-21(28)23-8-9-26(18)16-17-5-2-1-3-6-17/h1-7,14,18H,8-13,15-16H2,(H,23,28)/t18-/m1/s1 |
| InChIKey | WOPAFCVJRMVFPT-GOSISDBHSA-N |
| XLogP | 0.95 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |