C21H31N5O2 — CID 75590147
4-benzyl-3-[2-(3-ethyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-oxoethyl]piperazin-2-one (PubChem CID 75590147) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-benzyl-3-[2-(3-ethyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-oxoethyl]piperazin-2-one.
| Compound Name | 4-benzyl-3-[2-(3-ethyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-oxoethyl]piperazin-2-one |
|---|---|
| PubChem CID | 75590147 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 4-benzyl-3-[2-(3-ethyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-oxoethyl]piperazin-2-one |
| SMILES | CCC1NNC2CCN(C(=O)CC3C(=O)NCCN3Cc3ccccc3)CC12 |
| InChI | InChI=1S/C21H31N5O2/c1-2-17-16-14-26(10-8-18(16)24-23-17)20(27)12-19-21(28)22-9-11-25(19)13-15-6-4-3-5-7-15/h3-7,16-19,23-24H,2,8-14H2,1H3,(H,22,28) |
| InChIKey | APSHHCALNPGWSW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |