C15H21N3O3S — CID 45238416
4-(furan-3-ylmethyl)-3-(2-oxo-2-thiomorpholin-4-ylethyl)piperazin-2-one (PubChem CID 45238416) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 4-(furan-3-ylmethyl)-3-(2-oxo-2-thiomorpholin-4-ylethyl)piperazin-2-one.
| Compound Name | 4-(furan-3-ylmethyl)-3-(2-oxo-2-thiomorpholin-4-ylethyl)piperazin-2-one |
|---|---|
| PubChem CID | 45238416 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-(furan-3-ylmethyl)-3-(2-oxo-2-thiomorpholin-4-ylethyl)piperazin-2-one |
| SMILES | O=C1NCCN(Cc2ccoc2)C1CC(=O)N1CCSCC1 |
| InChI | InChI=1S/C15H21N3O3S/c19-14(17-4-7-22-8-5-17)9-13-15(20)16-2-3-18(13)10-12-1-6-21-11-12/h1,6,11,13H,2-5,7-10H2,(H,16,20) |
| InChIKey | YTDHATLHXQDCNE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |