C18H28N4O4 — CID 45170722
4-(furan-3-ylmethyl)-3-[2-[4-(2-methoxyethyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one (PubChem CID 45170722) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-(furan-3-ylmethyl)-3-[2-[4-(2-methoxyethyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one.
| Compound Name | 4-(furan-3-ylmethyl)-3-[2-[4-(2-methoxyethyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one |
|---|---|
| PubChem CID | 45170722 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 4-(furan-3-ylmethyl)-3-[2-[4-(2-methoxyethyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one |
| SMILES | COCCN1CCN(C(=O)CC2C(=O)NCCN2Cc2ccoc2)CC1 |
| InChI | InChI=1S/C18H28N4O4/c1-25-11-9-20-5-7-21(8-6-20)17(23)12-16-18(24)19-3-4-22(16)13-15-2-10-26-14-15/h2,10,14,16H,3-9,11-13H2,1H3,(H,19,24) |
| InChIKey | ZZXVLKFRCFLXQI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |