C18H27N5O2 — CID 46987810
N-cyclopentyl-4-oxo-4-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)butanamide (PubChem CID 46987810) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-cyclopentyl-4-oxo-4-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)butanamide.
| Compound Name | N-cyclopentyl-4-oxo-4-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)butanamide |
|---|---|
| PubChem CID | 46987810 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | N-cyclopentyl-4-oxo-4-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)butanamide |
| SMILES | O=C(CCC(=O)N1CCCN(c2ncccn2)CC1)NC1CCCC1 |
| InChI | InChI=1S/C18H27N5O2/c24-16(21-15-5-1-2-6-15)7-8-17(25)22-11-4-12-23(14-13-22)18-19-9-3-10-20-18/h3,9-10,15H,1-2,4-8,11-14H2,(H,21,24) |
| InChIKey | GPSHLDAVAPPWKL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |