C15H19N5O3 — CID 164610328
5-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]imidazolidine-2,4-dione (PubChem CID 164610328) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 5-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 164610328 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 5-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCC(=O)N2CCN(c3ccccn3)CC2)N1 |
| InChI | InChI=1S/C15H19N5O3/c21-13(5-4-11-14(22)18-15(23)17-11)20-9-7-19(8-10-20)12-3-1-2-6-16-12/h1-3,6,11H,4-5,7-10H2,(H2,17,18,22,23) |
| InChIKey | MNMPVXNVSMGNQL-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|