C17H23N5O3 — CID 70776688
5-[3-oxo-3-[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]propyl]imidazolidine-2,4-dione (PubChem CID 70776688) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-[3-oxo-3-[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-oxo-3-[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70776688 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 5-[3-oxo-3-[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCC(=O)N2CCCN(Cc3ccccn3)CC2)N1 |
| InChI | InChI=1S/C17H23N5O3/c23-15(6-5-14-16(24)20-17(25)19-14)22-9-3-8-21(10-11-22)12-13-4-1-2-7-18-13/h1-2,4,7,14H,3,5-6,8-12H2,(H2,19,20,24,25) |
| InChIKey | IAFSPRQDTLDNSZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|