C19H31N5O4 — CID 134700248
(5S)-5-[3-[4-[2-(azepan-1-yl)acetyl]-1,4-diazepan-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 134700248) has the molecular formula C19H31N5O4 and a molecular weight of 393.49 g/mol. Its IUPAC name is (5S)-5-[3-[4-[2-(azepan-1-yl)acetyl]-1,4-diazepan-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[3-[4-[2-(azepan-1-yl)acetyl]-1,4-diazepan-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134700248 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | (5S)-5-[3-[4-[2-(azepan-1-yl)acetyl]-1,4-diazepan-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H](CCC(=O)N2CCCN(C(=O)CN3CCCCCC3)CC2)N1 |
| InChI | InChI=1S/C19H31N5O4/c25-16(7-6-15-18(27)21-19(28)20-15)23-10-5-11-24(13-12-23)17(26)14-22-8-3-1-2-4-9-22/h15H,1-14H2,(H2,20,21,27,28)/t15-/m0/s1 |
| InChIKey | VCLFNPNWUCUBEK-HNNXBMFYSA-N |
| XLogP | -0.09 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|