C17H23N5O3 — CID 97114558
(5R)-5-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 97114558) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is (5R)-5-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97114558 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (5R)-5-[3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(N2CCN(C(=O)CC[C@H]3NC(=O)NC3=O)CC2)cc(C)n1 |
| InChI | InChI=1S/C17H23N5O3/c1-11-9-13(10-12(2)18-11)21-5-7-22(8-6-21)15(23)4-3-14-16(24)20-17(25)19-14/h9-10,14H,3-8H2,1-2H3,(H2,19,20,24,25)/t14-/m1/s1 |
| InChIKey | GDMFXJRVSRMPRG-CQSZACIVSA-N |
| XLogP | 0.34 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|