C14H22N4O3 — CID 131942530
(5S)-5-[3-oxo-3-(3-piperidin-1-ylazetidin-1-yl)propyl]imidazolidine-2,4-dione (PubChem CID 131942530) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (5S)-5-[3-oxo-3-(3-piperidin-1-ylazetidin-1-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[3-oxo-3-(3-piperidin-1-ylazetidin-1-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 131942530 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (5S)-5-[3-oxo-3-(3-piperidin-1-ylazetidin-1-yl)propyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H](CCC(=O)N2CC(N3CCCCC3)C2)N1 |
| InChI | InChI=1S/C14H22N4O3/c19-12(5-4-11-13(20)16-14(21)15-11)18-8-10(9-18)17-6-2-1-3-7-17/h10-11H,1-9H2,(H2,15,16,20,21)/t11-/m0/s1 |
| InChIKey | WPDRCMIDFALIFD-NSHDSACASA-N |
| XLogP | -0.33 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|