C18H24N4O3 — CID 56808778
5-[2-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 56808778) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 5-[2-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56808778 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5-[2-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccccc1CN1CCCN(C(=O)CC2NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C18H24N4O3/c1-13-5-2-3-6-14(13)12-21-7-4-8-22(10-9-21)16(23)11-15-17(24)20-18(25)19-15/h2-3,5-6,15H,4,7-12H2,1H3,(H2,19,20,24,25) |
| InChIKey | LYNGSGCUXCSDHA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|