C16H11F15N4O — CID 13298553
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-(4-pyrazin-2-ylpiperazin-1-yl)octan-1-one (PubChem CID 13298553) has the molecular formula C16H11F15N4O and a molecular weight of 560.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-(4-pyrazin-2-ylpiperazin-1-yl)octan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-(4-pyrazin-2-ylpiperazin-1-yl)octan-1-one |
|---|---|
| PubChem CID | 13298553 |
| Molecular Formula | C16H11F15N4O |
| Molecular Weight | 560.26 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-(4-pyrazin-2-ylpiperazin-1-yl)octan-1-one |
| SMILES | O=C(N1CCN(c2cnccn2)CC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H11F15N4O/c17-10(18,9(36)35-5-3-34(4-6-35)8-7-32-1-2-33-8)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)31/h1-2,7H,3-6H2 |
| InChIKey | PTNKZHMZGDPKMB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|