C14H15F3N6O — CID 56814513
[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone (PubChem CID 56814513) has the molecular formula C14H15F3N6O and a molecular weight of 340.31 g/mol. Its IUPAC name is [1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 56814513 |
| Molecular Formula | C14H15F3N6O |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cn1cc(C(=O)N2CCN(c3cnccn3)CC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H15F3N6O/c1-21-9-10(12(20-21)14(15,16)17)13(24)23-6-4-22(5-7-23)11-8-18-2-3-19-11/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | GVNCJBVMCOGMDJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |