C19H25ClN4O — CID 7928741
[(5S,7R)-3-chloro-1-adamantyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 7928741) has the molecular formula C19H25ClN4O and a molecular weight of 360.89 g/mol. Its IUPAC name is [(5S,7R)-3-chloro-1-adamantyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [(5S,7R)-3-chloro-1-adamantyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 7928741 |
| Molecular Formula | C19H25ClN4O |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [(5S,7R)-3-chloro-1-adamantyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(N1CCN(c2ncccn2)CC1)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C19H25ClN4O/c20-19-11-14-8-15(12-19)10-18(9-14,13-19)16(25)23-4-6-24(7-5-23)17-21-2-1-3-22-17/h1-3,14-15H,4-13H2/t14-,15+,18?,19? |
| InChIKey | JFNCGUVPWWPKFT-MYMYQCDVSA-N |
| XLogP | 2.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|