C24H31ClN2O3S — CID 98443047
[(5R,7R)-3-chloro-1-adamantyl]-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]methanone (PubChem CID 98443047) has the molecular formula C24H31ClN2O3S and a molecular weight of 463.04 g/mol. Its IUPAC name is [(5R,7R)-3-chloro-1-adamantyl]-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]methanone.
| Compound Name | [(5R,7R)-3-chloro-1-adamantyl]-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 98443047 |
| Molecular Formula | C24H31ClN2O3S |
| Molecular Weight | 463.04 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [(5R,7R)-3-chloro-1-adamantyl]-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]methanone |
| SMILES | O=C(N1CCN(S(=O)(=O)c2ccc3c(c2)CCC3)CC1)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C24H31ClN2O3S/c25-24-14-17-10-18(15-24)13-23(12-17,16-24)22(28)26-6-8-27(9-7-26)31(29,30)21-5-4-19-2-1-3-20(19)11-21/h4-5,11,17-18H,1-3,6-10,12-16H2/t17-,18-,23?,24?/m1/s1 |
| InChIKey | PJKAXXALRINALL-RDNZODCXSA-N |
| XLogP | 3.59 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.04 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|