C22H29ClN2O3S — CID 98298934
[(5R,7R)-3-chloro-1-adamantyl]-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 98298934) has the molecular formula C22H29ClN2O3S and a molecular weight of 437.01 g/mol. Its IUPAC name is [(5R,7R)-3-chloro-1-adamantyl]-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [(5R,7R)-3-chloro-1-adamantyl]-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 98298934 |
| Molecular Formula | C22H29ClN2O3S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [(5R,7R)-3-chloro-1-adamantyl]-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)C34C[C@H]5C[C@@H](CC(Cl)(C5)C3)C4)CC2)cc1 |
| InChI | InChI=1S/C22H29ClN2O3S/c1-16-2-4-19(5-3-16)29(27,28)25-8-6-24(7-9-25)20(26)21-11-17-10-18(12-21)14-22(23,13-17)15-21/h2-5,17-18H,6-15H2,1H3/t17-,18-,21?,22?/m1/s1 |
| InChIKey | PPDQKLIZBYBXRU-NFAVZRQZSA-N |
| XLogP | 3.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|