C22H28N6O2 — CID 108531669
1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 108531669) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 108531669 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | Cc1cccc(N2CCN(C(=O)C(=O)N3CCN(c4ncccn4)CC3)CC2)c1C |
| InChI | InChI=1S/C22H28N6O2/c1-17-5-3-6-19(18(17)2)25-9-11-26(12-10-25)20(29)21(30)27-13-15-28(16-14-27)22-23-7-4-8-24-22/h3-8H,9-16H2,1-2H3 |
| InChIKey | BDQUOTSDAYEVGD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|