C20H28N4O3 — CID 108532094
1-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoacetyl]piperidine-4-carboxamide (PubChem CID 108532094) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108532094 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoacetyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C(=O)N3CCC(C(N)=O)CC3)CC2)c1C |
| InChI | InChI=1S/C20H28N4O3/c1-14-4-3-5-17(15(14)2)22-10-12-24(13-11-22)20(27)19(26)23-8-6-16(7-9-23)18(21)25/h3-5,16H,6-13H2,1-2H3,(H2,21,25) |
| InChIKey | NPHOUFUKIWVUGH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|