C25H32N4O3 — CID 108530720
1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 108530720) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 108530720 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | COc1ccccc1N1CCN(C(=O)C(=O)N2CCN(c3cccc(C)c3C)CC2)CC1 |
| InChI | InChI=1S/C25H32N4O3/c1-19-7-6-9-21(20(19)2)26-11-15-28(16-12-26)24(30)25(31)29-17-13-27(14-18-29)22-8-4-5-10-23(22)32-3/h4-10H,11-18H2,1-3H3 |
| InChIKey | NTUVSBSNVXFEQC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|