C22H27N5O3 — CID 108530749
1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 108530749) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 108530749 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | COc1ccccc1N1CCN(C(=O)C(=O)N2CCN(c3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C22H27N5O3/c1-30-19-7-3-2-6-18(19)24-10-14-26(15-11-24)21(28)22(29)27-16-12-25(13-17-27)20-8-4-5-9-23-20/h2-9H,10-17H2,1H3 |
| InChIKey | XWFHNRNWEUVDNP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 69.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|