C22H29ClN4O3 — CID 108832351
1-[(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enoyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 108832351) has the molecular formula C22H29ClN4O3 and a molecular weight of 432.95 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enoyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enoyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 108832351 |
| Molecular Formula | C22H29ClN4O3 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-[(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enoyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cc1cccc(N2CCN(/C=C(/C#N)C(=O)N3CCC(C(=O)O)CC3)CC2)c1C.Cl |
| InChI | InChI=1S/C22H28N4O3.ClH/c1-16-4-3-5-20(17(16)2)25-12-10-24(11-13-25)15-19(14-23)21(27)26-8-6-18(7-9-26)22(28)29;/h3-5,15,18H,6-13H2,1-2H3,(H,28,29);1H/b19-15-; |
| InChIKey | HTVMOYSWMLGQNG-HVENRQQKSA-N |
| XLogP | 2.58 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|