C20H24N4O3 — CID 108832353
1-[(Z)-2-cyano-3-(4-phenylpiperazin-1-yl)prop-2-enoyl]piperidine-4-carboxylic acid (PubChem CID 108832353) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-3-(4-phenylpiperazin-1-yl)prop-2-enoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(Z)-2-cyano-3-(4-phenylpiperazin-1-yl)prop-2-enoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 108832353 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[(Z)-2-cyano-3-(4-phenylpiperazin-1-yl)prop-2-enoyl]piperidine-4-carboxylic acid |
| SMILES | N#C/C(=C/N1CCN(c2ccccc2)CC1)C(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C20H24N4O3/c21-14-17(19(25)24-8-6-16(7-9-24)20(26)27)15-22-10-12-23(13-11-22)18-4-2-1-3-5-18/h1-5,15-16H,6-13H2,(H,26,27)/b17-15- |
| InChIKey | KISLMQGZQCOXQL-ICFOKQHNSA-N |
| XLogP | 1.54 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|