C27H32N4O — CID 108831735
(Z)-3-(4-benzhydrylpiperazin-1-yl)-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 108831735) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is (Z)-3-(4-benzhydrylpiperazin-1-yl)-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(4-benzhydrylpiperazin-1-yl)-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108831735 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (Z)-3-(4-benzhydrylpiperazin-1-yl)-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | CC1CCN(C(=O)/C(C#N)=C\N2CCN(C(c3ccccc3)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C27H32N4O/c1-22-12-14-31(15-13-22)27(32)25(20-28)21-29-16-18-30(19-17-29)26(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-11,21-22,26H,12-19H2,1H3/b25-21- |
| InChIKey | KLOUAHWDCYAIKZ-DAFNUICNSA-N |
| XLogP | 4.06 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|