C25H28N4O3S — CID 108832637
(Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enenitrile (PubChem CID 108832637) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108832637 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enenitrile |
| SMILES | N#C/C(=C/NC1CCS(=O)(=O)C1)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N4O3S/c26-17-22(18-27-23-11-16-33(31,32)19-23)25(30)29-14-12-28(13-15-29)24(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10,18,23-24,27H,11-16,19H2/b22-18- |
| InChIKey | FBMNYMIXGVONTJ-PYCFMQQDSA-N |
| XLogP | 2.10 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|