C29H35N5O3 — CID 108832704
ethyl 4-[[(Z)-3-(4-benzhydrylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate (PubChem CID 108832704) has the molecular formula C29H35N5O3 and a molecular weight of 501.63 g/mol. Its IUPAC name is ethyl 4-[[(Z)-3-(4-benzhydrylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(Z)-3-(4-benzhydrylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108832704 |
| Molecular Formula | C29H35N5O3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | ethyl 4-[[(Z)-3-(4-benzhydrylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C=C(/C#N)C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C29H35N5O3/c1-2-37-29(36)34-15-13-26(14-16-34)31-22-25(21-30)28(35)33-19-17-32(18-20-33)27(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-12,22,26-27,31H,2,13-20H2,1H3/b25-22- |
| InChIKey | YDCSJLSOVVOVES-LVWGJNHUSA-N |
| XLogP | 3.54 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|