C23H25N3O2 — CID 17154981
ethyl (E)-3-(4-benzhydrylpiperazin-1-yl)-2-cyanoprop-2-enoate (PubChem CID 17154981) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl (E)-3-(4-benzhydrylpiperazin-1-yl)-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-(4-benzhydrylpiperazin-1-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 17154981 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | ethyl (E)-3-(4-benzhydrylpiperazin-1-yl)-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N3O2/c1-2-28-23(27)21(17-24)18-25-13-15-26(16-14-25)22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,18,22H,2,13-16H2,1H3/b21-18+ |
| InChIKey | RPKTUPSUZDKQLJ-DYTRJAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|