C31H34N4O — CID 108822433
(Z)-3-(4-benzhydrylpiperazin-1-yl)-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide (PubChem CID 108822433) has the molecular formula C31H34N4O and a molecular weight of 478.64 g/mol. Its IUPAC name is (Z)-3-(4-benzhydrylpiperazin-1-yl)-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-benzhydrylpiperazin-1-yl)-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108822433 |
| Molecular Formula | C31H34N4O |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (Z)-3-(4-benzhydrylpiperazin-1-yl)-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)/C(C#N)=C\N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H34N4O/c1-23(2)28-16-10-11-24(3)29(28)33-31(36)27(21-32)22-34-17-19-35(20-18-34)30(25-12-6-4-7-13-25)26-14-8-5-9-15-26/h4-16,22-23,30H,17-20H2,1-3H3,(H,33,36)/b27-22- |
| InChIKey | OREBNXTWYBZCTJ-QYQHSDTDSA-N |
| XLogP | 5.87 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|