C23H26N4O3 — CID 108822697
(Z)-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide (PubChem CID 108822697) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108822697 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (Z)-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)/C(C#N)=C\N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C23H26N4O3/c1-16(2)19-7-4-6-17(3)21(19)25-22(28)18(14-24)15-26-9-11-27(12-10-26)23(29)20-8-5-13-30-20/h4-8,13,15-16H,9-12H2,1-3H3,(H,25,28)/b18-15- |
| InChIKey | QFECBCJHSWXMFB-SDXDJHTJSA-N |
| XLogP | 3.52 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|