C25H32N4O3 — CID 108842741
(Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enamide (PubChem CID 108842741) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enamide.
| Compound Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108842741 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C\N1CCN(C(=O)c2ccco2)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H32N4O3/c1-17(25-12-18-9-19(13-25)11-20(10-18)14-25)27-23(30)21(15-26)16-28-4-6-29(7-5-28)24(31)22-3-2-8-32-22/h2-3,8,16-20H,4-7,9-14H2,1H3,(H,27,30)/b21-16- |
| InChIKey | OFCYRHIAZAQGFX-PGMHBOJBSA-N |
| XLogP | 3.17 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|