C23H34N4O3 — CID 108842744
ethyl 4-[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108842744) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is ethyl 4-[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108842744 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | ethyl 4-[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C=C(/C#N)C(=O)NC(C)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C23H34N4O3/c1-3-30-22(29)27-6-4-26(5-7-27)15-20(14-24)21(28)25-16(2)23-11-17-8-18(12-23)10-19(9-17)13-23/h15-19H,3-13H2,1-2H3,(H,25,28)/b20-15- |
| InChIKey | ZVNQSGBUIRGKCE-HKWRFOASSA-N |
| XLogP | 2.89 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|