C22H35N3O — CID 108842655
(Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(dipropylamino)prop-2-enamide (PubChem CID 108842655) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(dipropylamino)prop-2-enamide.
| Compound Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(dipropylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108842655 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(dipropylamino)prop-2-enamide |
| SMILES | CCCN(/C=C(/C#N)C(=O)NC(C)C12CC3CC(CC(C3)C1)C2)CCC |
| InChI | InChI=1S/C22H35N3O/c1-4-6-25(7-5-2)15-20(14-23)21(26)24-16(3)22-11-17-8-18(12-22)10-19(9-17)13-22/h15-19H,4-13H2,1-3H3,(H,24,26)/b20-15- |
| InChIKey | HYPPLGBHUVAPFO-HKWRFOASSA-N |
| XLogP | 4.24 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|