C20H29N3O2 — CID 108842507
(Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-morpholin-4-ylprop-2-enamide (PubChem CID 108842507) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-morpholin-4-ylprop-2-enamide.
| Compound Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-morpholin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 108842507 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-morpholin-4-ylprop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C\N1CCOCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H29N3O2/c1-14(20-9-15-6-16(10-20)8-17(7-15)11-20)22-19(24)18(12-21)13-23-2-4-25-5-3-23/h13-17H,2-11H2,1H3,(H,22,24)/b18-13- |
| InChIKey | MMJNWVUYTCEHJZ-AQTBWJFISA-N |
| XLogP | 2.45 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|