C26H35N3O — CID 108842522
(Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(2,6-diethylanilino)prop-2-enamide (PubChem CID 108842522) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(2,6-diethylanilino)prop-2-enamide.
| Compound Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(2,6-diethylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108842522 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(2,6-diethylanilino)prop-2-enamide |
| SMILES | CCc1cccc(CC)c1N/C=C(/C#N)C(=O)NC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H35N3O/c1-4-21-7-6-8-22(5-2)24(21)28-16-23(15-27)25(30)29-17(3)26-12-18-9-19(13-26)11-20(10-18)14-26/h6-8,16-20,28H,4-5,9-14H2,1-3H3,(H,29,30)/b23-16- |
| InChIKey | PNPAMOSDIKIZKZ-KQWNVCNZSA-N |
| XLogP | 5.35 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|