C24H30BrN3O — CID 108842773
(Z)-N-[1-(1-adamantyl)ethyl]-3-[2-(2-bromophenyl)ethylamino]-2-cyanoprop-2-enamide (PubChem CID 108842773) has the molecular formula C24H30BrN3O and a molecular weight of 456.43 g/mol. Its IUPAC name is (Z)-N-[1-(1-adamantyl)ethyl]-3-[2-(2-bromophenyl)ethylamino]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-[1-(1-adamantyl)ethyl]-3-[2-(2-bromophenyl)ethylamino]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108842773 |
| Molecular Formula | C24H30BrN3O |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | (Z)-N-[1-(1-adamantyl)ethyl]-3-[2-(2-bromophenyl)ethylamino]-2-cyanoprop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C\NCCc1ccccc1Br)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H30BrN3O/c1-16(24-11-17-8-18(12-24)10-19(9-17)13-24)28-23(29)21(14-26)15-27-7-6-20-4-2-3-5-22(20)25/h2-5,15-19,27H,6-13H2,1H3,(H,28,29)/b21-15- |
| InChIKey | IHYDPTFMWACSRK-QNGOZBTKSA-N |
| XLogP | 4.71 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|