C24H29N3O3 — CID 108842593
4-[[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoic acid (PubChem CID 108842593) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-[[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108842593 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 4-[[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoic acid |
| SMILES | CC(NC(=O)/C(C#N)=C\NCc1ccc(C(=O)O)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H29N3O3/c1-15(24-9-17-6-18(10-24)8-19(7-17)11-24)27-22(28)21(12-25)14-26-13-16-2-4-20(5-3-16)23(29)30/h2-5,14-15,17-19,26H,6-11,13H2,1H3,(H,27,28)(H,29,30)/b21-14- |
| InChIKey | OATUXKHXMTVQLI-STZFKDTASA-N |
| XLogP | 3.60 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|