C23H28FN3O — CID 108842765
(Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-[(3-fluorophenyl)methylamino]prop-2-enamide (PubChem CID 108842765) has the molecular formula C23H28FN3O and a molecular weight of 381.50 g/mol. Its IUPAC name is (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-[(3-fluorophenyl)methylamino]prop-2-enamide.
| Compound Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-[(3-fluorophenyl)methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108842765 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-[(3-fluorophenyl)methylamino]prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C\NCc1cccc(F)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H28FN3O/c1-15(23-9-17-5-18(10-23)7-19(6-17)11-23)27-22(28)20(12-25)14-26-13-16-3-2-4-21(24)8-16/h2-4,8,14-15,17-19,26H,5-7,9-11,13H2,1H3,(H,27,28)/b20-14- |
| InChIKey | DPVLRQCWKWDJJE-ZHZULCJRSA-N |
| XLogP | 4.04 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|