C25H31N3O3 — CID 108842759
methyl 4-[[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoate (PubChem CID 108842759) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is methyl 4-[[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 108842759 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | methyl 4-[[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN/C=C(/C#N)C(=O)NC(C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H31N3O3/c1-16(25-10-18-7-19(11-25)9-20(8-18)12-25)28-23(29)22(13-26)15-27-14-17-3-5-21(6-4-17)24(30)31-2/h3-6,15-16,18-20,27H,7-12,14H2,1-2H3,(H,28,29)/b22-15- |
| InChIKey | VUESFBOZNIBZFI-JCMHNJIXSA-N |
| XLogP | 3.69 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|