C23H28N4O2 — CID 108842678
4-[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]benzamide (PubChem CID 108842678) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]benzamide.
| Compound Name | 4-[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]benzamide |
|---|---|
| PubChem CID | 108842678 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-[[(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-3-oxoprop-1-enyl]amino]benzamide |
| SMILES | CC(NC(=O)/C(C#N)=C\Nc1ccc(C(N)=O)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H28N4O2/c1-14(23-9-15-6-16(10-23)8-17(7-15)11-23)27-22(29)19(12-24)13-26-20-4-2-18(3-5-20)21(25)28/h2-5,13-17,26H,6-11H2,1H3,(H2,25,28)(H,27,29)/b19-13- |
| InChIKey | YZRWSMPUJYAMFB-UYRXBGFRSA-N |
| XLogP | 3.33 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|