C23H28N4O4 — CID 108842531
(Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(2-methoxy-4-nitroanilino)prop-2-enamide (PubChem CID 108842531) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(2-methoxy-4-nitroanilino)prop-2-enamide.
| Compound Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(2-methoxy-4-nitroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108842531 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (Z)-N-[1-(1-adamantyl)ethyl]-2-cyano-3-(2-methoxy-4-nitroanilino)prop-2-enamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1N/C=C(/C#N)C(=O)NC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H28N4O4/c1-14(23-9-15-5-16(10-23)7-17(6-15)11-23)26-22(28)18(12-24)13-25-20-4-3-19(27(29)30)8-21(20)31-2/h3-4,8,13-17,25H,5-7,9-11H2,1-2H3,(H,26,28)/b18-13- |
| InChIKey | IOZVCWCLESXGPW-AQTBWJFISA-N |
| XLogP | 4.14 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|