C22H25ClN4O3 — CID 108853680
(Z)-3-[1-(1-adamantyl)ethylamino]-N-(2-chloro-5-nitrophenyl)-2-cyanoprop-2-enamide (PubChem CID 108853680) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is (Z)-3-[1-(1-adamantyl)ethylamino]-N-(2-chloro-5-nitrophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[1-(1-adamantyl)ethylamino]-N-(2-chloro-5-nitrophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108853680 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (Z)-3-[1-(1-adamantyl)ethylamino]-N-(2-chloro-5-nitrophenyl)-2-cyanoprop-2-enamide |
| SMILES | CC(N/C=C(/C#N)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H25ClN4O3/c1-13(22-8-14-4-15(9-22)6-16(5-14)10-22)25-12-17(11-24)21(28)26-20-7-18(27(29)30)2-3-19(20)23/h2-3,7,12-16,25H,4-6,8-10H2,1H3,(H,26,28)/b17-12- |
| InChIKey | DZEUOLRPNLNNKE-ATVHPVEESA-N |
| XLogP | 4.79 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|