C23H29N3O — CID 108858529
(Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-N-(3-methylphenyl)prop-2-enamide (PubChem CID 108858529) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is (Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108858529 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (Z)-3-[1-(1-adamantyl)ethylamino]-2-cyano-N-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C\NC(C)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C23H29N3O/c1-15-4-3-5-21(6-15)26-22(27)20(13-24)14-25-16(2)23-10-17-7-18(11-23)9-19(8-17)12-23/h3-6,14,16-19,25H,7-12H2,1-2H3,(H,26,27)/b20-14- |
| InChIKey | AQYSFGGALGNYEW-ZHZULCJRSA-N |
| XLogP | 4.54 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|