C17H20N4O6 — CID 108846257
2-[[(Z)-2-cyano-3-(2-methoxy-4-nitroanilino)prop-2-enoyl]amino]-4-methylpentanoic acid (PubChem CID 108846257) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-(2-methoxy-4-nitroanilino)prop-2-enoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-(2-methoxy-4-nitroanilino)prop-2-enoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 108846257 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-(2-methoxy-4-nitroanilino)prop-2-enoyl]amino]-4-methylpentanoic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1N/C=C(/C#N)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C17H20N4O6/c1-10(2)6-14(17(23)24)20-16(22)11(8-18)9-19-13-5-4-12(21(25)26)7-15(13)27-3/h4-5,7,9-10,14,19H,6H2,1-3H3,(H,20,22)(H,23,24)/b11-9- |
| InChIKey | HGCCTANPDZJASS-LUAWRHEFSA-N |
| XLogP | 2.04 |
| TPSA | 154.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|