C11H14N4O2 — CID 110190559
ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate (PubChem CID 110190559) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110190559 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C=C(C#N)C#N)CC1 |
| InChI | InChI=1S/C11H14N4O2/c1-2-17-11(16)15-5-3-14(4-6-15)9-10(7-12)8-13/h9H,2-6H2,1H3 |
| InChIKey | WAJBWHFHEFHPDA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|