About ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate
ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate (PubChem CID 110190559) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate |
| PubChem CID | 110190559 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C=C(C#N)C#N)CC1 |
| InChI | InChI=1S/C11H14N4O2/c1-2-17-11(16)15-5-3-14(4-6-15)9-10(7-12)8-13/h9H,2-6H2,1H3 |
| InChIKey | WAJBWHFHEFHPDA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate?
The IUPAC name of ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate (CID 110190559) is ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate is CCOC(=O)N1CCN(C=C(C#N)C#N)CC1.
What is the InChIKey of ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate?
The InChIKey is WAJBWHFHEFHPDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-2-17-11(16)15-5-3-14(4-6-15)9-10(7-12)8-13/h9H,2-6H2,1H3.
What are the key properties of ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate?
ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate has a molecular weight of 234.26 g/mol, XLogP of 0.69, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,2-dicyanoethenyl)piperazine-1-carboxylate is sourced from PubChem (CID 110190559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).